C25H39N7O12 — CID 4553232
ditert-butyl 2-[4-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]-2-nitropropanedioate (PubChem CID 4553232) has the molecular formula C25H39N7O12 and a molecular weight of 629.62 g/mol. Its IUPAC name is ditert-butyl 2-[4-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]-2-nitropropanedioate.
| Compound Name | ditert-butyl 2-[4-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]-2-nitropropanedioate |
|---|---|
| PubChem CID | 4553232 |
| Molecular Formula | C25H39N7O12 |
| Molecular Weight | 629.62 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | ditert-butyl 2-[4-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]-2-nitropropanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)(c1nc(NN)nc(C(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)[N+](=O)[O-])n1)[N+](=O)[O-] |
| InChI | InChI=1S/C25H39N7O12/c1-20(2,3)41-15(33)24(31(37)38,16(34)42-21(4,5)6)13-27-14(29-19(28-13)30-26)25(32(39)40,17(35)43-22(7,8)9)18(36)44-23(10,11)12/h26H2,1-12H3,(H,27,28,29,30) |
| InChIKey | IHLWMOVLLFRHCW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 268.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.62 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|