C18H15N3O6 — CID 4553539
2-(2,4-dimethoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one (PubChem CID 4553539) has the molecular formula C18H15N3O6 and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one.
| Compound Name | 2-(2,4-dimethoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
|---|---|
| PubChem CID | 4553539 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-7-nitro-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
| SMILES | COc1ccc(C2OC3=C(Nc4ccc([N+](=O)[O-])cc4N3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C18H15N3O6/c1-25-10-4-5-11(14(8-10)26-2)17-16(22)15-18(27-17)20-13-7-9(21(23)24)3-6-12(13)19-15/h3-8,17,19-20H,1-2H3 |
| InChIKey | YIZVBNZPFSEMKE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|