C20H30N2+2 — CID 4554221
2,4,6-trimethyl-1-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)butyl]pyridin-1-ium (PubChem CID 4554221) has the molecular formula C20H30N2+2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2,4,6-trimethyl-1-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)butyl]pyridin-1-ium.
| Compound Name | 2,4,6-trimethyl-1-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)butyl]pyridin-1-ium |
|---|---|
| PubChem CID | 4554221 |
| Molecular Formula | C20H30N2+2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2,4,6-trimethyl-1-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)butyl]pyridin-1-ium |
| SMILES | Cc1cc(C)[n+](CCCC[n+]2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H30N2/c1-15-11-17(3)21(18(4)12-15)9-7-8-10-22-19(5)13-16(2)14-20(22)6/h11-14H,7-10H2,1-6H3/q+2 |
| InChIKey | QUHGCUQSYQADEQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|