C14H12N2O5 — CID 4554432
5-[[4-(oxiran-2-ylmethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 4554432) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 5-[[4-(oxiran-2-ylmethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-(oxiran-2-ylmethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4554432 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-[[4-(oxiran-2-ylmethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OCC3CO3)cc2)C(=O)N1 |
| InChI | InChI=1S/C14H12N2O5/c17-12-11(13(18)16-14(19)15-12)5-8-1-3-9(4-2-8)20-6-10-7-21-10/h1-5,10H,6-7H2,(H2,15,16,17,18,19) |
| InChIKey | CHCCDQFIZLCPOC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|