C15H16N2O2S — CID 4554620
2-(2-hydroxy-4-methylphenyl)-5,6-dimethyl-2,3-dihydro-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 4554620) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-(2-hydroxy-4-methylphenyl)-5,6-dimethyl-2,3-dihydro-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-hydroxy-4-methylphenyl)-5,6-dimethyl-2,3-dihydro-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4554620 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-(2-hydroxy-4-methylphenyl)-5,6-dimethyl-2,3-dihydro-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(C2NC(=O)c3c(sc(C)c3C)N2)c(O)c1 |
| InChI | InChI=1S/C15H16N2O2S/c1-7-4-5-10(11(18)6-7)13-16-14(19)12-8(2)9(3)20-15(12)17-13/h4-6,13,17-18H,1-3H3,(H,16,19) |
| InChIKey | MOSMWOVZLDTWJS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|