C14H15ClO3 — CID 4554745
6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione (PubChem CID 4554745) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione.
| Compound Name | 6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 4554745 |
| Molecular Formula | C14H15ClO3 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione |
| SMILES | CC1C(=O)OC(c2ccc(Cl)cc2)C(C)(C)C1=O |
| InChI | InChI=1S/C14H15ClO3/c1-8-11(16)14(2,3)12(18-13(8)17)9-4-6-10(15)7-5-9/h4-8,12H,1-3H3 |
| InChIKey | KICZPBKOQVADTA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|