About 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium
1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium (PubChem CID 4554826) has the molecular formula C29H21BrN+
and a molecular weight of 463.40 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium |
| PubChem CID | 4554826 |
| Molecular Formula | C29H21BrN+ |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium |
| SMILES | Brc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21BrN/c30-26-16-18-27(19-17-26)31-28(23-12-6-2-7-13-23)20-25(22-10-4-1-5-11-22)21-29(31)24-14-8-3-9-15-24/h1-21H/q+1 |
| InChIKey | UWGFPAYMTGWPGY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium?
The IUPAC name of 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium (CID 4554826) is 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium.
What is the SMILES notation for 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium?
The canonical SMILES for 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium is Brc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.
What is the InChIKey of 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium?
The InChIKey is UWGFPAYMTGWPGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21BrN/c30-26-16-18-27(19-17-26)31-28(23-12-6-2-7-13-23)20-25(22-10-4-1-5-11-22)21-29(31)24-14-8-3-9-15-24/h1-21H/q+1.
What are the key properties of 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium?
1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium has a molecular weight of 463.40 g/mol, XLogP of 7.73, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2,4,6-triphenylpyridin-1-ium is sourced from PubChem (CID 4554826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).