About N,N',N'-tribenzylbutanediamide
N,N',N'-tribenzylbutanediamide (PubChem CID 4555128) has the molecular formula C25H26N2O2
and a molecular weight of 386.50 g/mol. Its IUPAC name is N,N',N'-tribenzylbutanediamide.
Molecular Properties
| Compound Name | N,N',N'-tribenzylbutanediamide |
| PubChem CID | 4555128 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N,N',N'-tribenzylbutanediamide |
| SMILES | O=C(CCC(=O)N(Cc1ccccc1)Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O2/c28-24(26-18-21-10-4-1-5-11-21)16-17-25(29)27(19-22-12-6-2-7-13-22)20-23-14-8-3-9-15-23/h1-15H,16-20H2,(H,26,28) |
| InChIKey | RJFZGLVEVWAWIZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N',N'-tribenzylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N',N'-tribenzylbutanediamide?
The IUPAC name of N,N',N'-tribenzylbutanediamide (CID 4555128) is N,N',N'-tribenzylbutanediamide.
What is the SMILES notation for N,N',N'-tribenzylbutanediamide?
The canonical SMILES for N,N',N'-tribenzylbutanediamide is O=C(CCC(=O)N(Cc1ccccc1)Cc1ccccc1)NCc1ccccc1.
What is the InChIKey of N,N',N'-tribenzylbutanediamide?
The InChIKey is RJFZGLVEVWAWIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O2/c28-24(26-18-21-10-4-1-5-11-21)16-17-25(29)27(19-22-12-6-2-7-13-22)20-23-14-8-3-9-15-23/h1-15H,16-20H2,(H,26,28).
What are the key properties of N,N',N'-tribenzylbutanediamide?
N,N',N'-tribenzylbutanediamide has a molecular weight of 386.50 g/mol, XLogP of 4.31, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N',N'-tribenzylbutanediamide is sourced from PubChem (CID 4555128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).