C12H8N2O3S — CID 4556265
5-phenyl-2-sulfanylidene-1,3-diazabicyclo[3.2.1]octane-4,6,8-trione (PubChem CID 4556265) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-phenyl-2-sulfanylidene-1,3-diazabicyclo[3.2.1]octane-4,6,8-trione.
| Compound Name | 5-phenyl-2-sulfanylidene-1,3-diazabicyclo[3.2.1]octane-4,6,8-trione |
|---|---|
| PubChem CID | 4556265 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 5-phenyl-2-sulfanylidene-1,3-diazabicyclo[3.2.1]octane-4,6,8-trione |
| SMILES | O=C1CN2C(=O)C1(c1ccccc1)C(=O)NC2=S |
| InChI | InChI=1S/C12H8N2O3S/c15-8-6-14-10(17)12(8,9(16)13-11(14)18)7-4-2-1-3-5-7/h1-5H,6H2,(H,13,16,18) |
| InChIKey | QJVQNEOKSIAGQS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|