C15H16N4O2S — CID 4557030
2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 4557030) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 4557030 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[[5-(2,3-dimethyl-1H-indol-5-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Cc1[nH]c2ccc(-c3nnc(SCC(=O)O)n3C)cc2c1C |
| InChI | InChI=1S/C15H16N4O2S/c1-8-9(2)16-12-5-4-10(6-11(8)12)14-17-18-15(19(14)3)22-7-13(20)21/h4-6,16H,7H2,1-3H3,(H,20,21) |
| InChIKey | HIGNIKAHZDELDM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|