About [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate
[1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate (PubChem CID 4557149) has the molecular formula C24H17N3O6S
and a molecular weight of 475.48 g/mol. Its IUPAC name is [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate |
| PubChem CID | 4557149 |
| Molecular Formula | C24H17N3O6S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate |
| SMILES | O=C(NN=Cc1c(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H17N3O6S/c28-24(18-7-2-1-3-8-18)26-25-16-22-21-9-5-4-6-17(21)10-15-23(22)33-34(31,32)20-13-11-19(12-14-20)27(29)30/h1-16H,(H,26,28) |
| InChIKey | RGMDYGPGSIBQQA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate?
The IUPAC name of [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate (CID 4557149) is [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate.
What is the SMILES notation for [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate?
The canonical SMILES for [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate is O=C(NN=Cc1c(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)ccc2ccccc12)c1ccccc1.
What is the InChIKey of [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate?
The InChIKey is RGMDYGPGSIBQQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N3O6S/c28-24(18-7-2-1-3-8-18)26-25-16-22-21-9-5-4-6-17(21)10-15-23(22)33-34(31,32)20-13-11-19(12-14-20)27(29)30/h1-16H,(H,26,28).
What are the key properties of [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate?
[1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate has a molecular weight of 475.48 g/mol, XLogP of 4.28, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(benzoylhydrazinylidene)methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate is sourced from PubChem (CID 4557149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).