About 3-phenyloxirane-2,2-dicarboxamide
3-phenyloxirane-2,2-dicarboxamide (PubChem CID 4557691) has the molecular formula C10H10N2O3
and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-phenyloxirane-2,2-dicarboxamide.
Molecular Properties
| Compound Name | 3-phenyloxirane-2,2-dicarboxamide |
| PubChem CID | 4557691 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-phenyloxirane-2,2-dicarboxamide |
| SMILES | NC(=O)C1(C(N)=O)OC1c1ccccc1 |
| InChI | InChI=1S/C10H10N2O3/c11-8(13)10(9(12)14)7(15-10)6-4-2-1-3-5-6/h1-5,7H,(H2,11,13)(H2,12,14) |
| InChIKey | MDHLZUKWMWDKGL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyloxirane-2,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyloxirane-2,2-dicarboxamide?
The IUPAC name of 3-phenyloxirane-2,2-dicarboxamide (CID 4557691) is 3-phenyloxirane-2,2-dicarboxamide.
What is the SMILES notation for 3-phenyloxirane-2,2-dicarboxamide?
The canonical SMILES for 3-phenyloxirane-2,2-dicarboxamide is NC(=O)C1(C(N)=O)OC1c1ccccc1.
What is the InChIKey of 3-phenyloxirane-2,2-dicarboxamide?
The InChIKey is MDHLZUKWMWDKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c11-8(13)10(9(12)14)7(15-10)6-4-2-1-3-5-6/h1-5,7H,(H2,11,13)(H2,12,14).
What are the key properties of 3-phenyloxirane-2,2-dicarboxamide?
3-phenyloxirane-2,2-dicarboxamide has a molecular weight of 206.20 g/mol, XLogP of -0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyloxirane-2,2-dicarboxamide is sourced from PubChem (CID 4557691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).