C18H15N — CID 4558435
13,15-dimethyl-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene (PubChem CID 4558435) has the molecular formula C18H15N and a molecular weight of 245.32 g/mol. Its IUPAC name is 13,15-dimethyl-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene.
| Compound Name | 13,15-dimethyl-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
|---|---|
| PubChem CID | 4558435 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 13,15-dimethyl-14-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
| SMILES | Cc1cc2c(c(C)n1)Cc1ccc3ccccc3c1-2 |
| InChI | InChI=1S/C18H15N/c1-11-9-17-16(12(2)19-11)10-14-8-7-13-5-3-4-6-15(13)18(14)17/h3-9H,10H2,1-2H3 |
| InChIKey | BJBXGNJUUOBXHI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |