C22H17NO3 — CID 4558442
3,4-dimethyl-N-(3-oxobenzo[f]chromen-2-yl)benzamide (PubChem CID 4558442) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3,4-dimethyl-N-(3-oxobenzo[f]chromen-2-yl)benzamide.
| Compound Name | 3,4-dimethyl-N-(3-oxobenzo[f]chromen-2-yl)benzamide |
|---|---|
| PubChem CID | 4558442 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3,4-dimethyl-N-(3-oxobenzo[f]chromen-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc3c(ccc4ccccc43)oc2=O)cc1C |
| InChI | InChI=1S/C22H17NO3/c1-13-7-8-16(11-14(13)2)21(24)23-19-12-18-17-6-4-3-5-15(17)9-10-20(18)26-22(19)25/h3-12H,1-2H3,(H,23,24) |
| InChIKey | LLYYSKIRZDAUPH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|