About (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone
(6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone (PubChem CID 4558532) has the molecular formula C16H20N2O2S
and a molecular weight of 304.42 g/mol. Its IUPAC name is (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone |
| PubChem CID | 4558532 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone |
| SMILES | CCOc1ccc2nc(C(=O)N3CCCC(C)C3)sc2c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-3-20-12-6-7-13-14(9-12)21-15(17-13)16(19)18-8-4-5-11(2)10-18/h6-7,9,11H,3-5,8,10H2,1-2H3 |
| InChIKey | NNUSATDXOPZUOY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone?
The IUPAC name of (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone (CID 4558532) is (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone.
What is the SMILES notation for (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone?
The canonical SMILES for (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone is CCOc1ccc2nc(C(=O)N3CCCC(C)C3)sc2c1.
What is the InChIKey of (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone?
The InChIKey is NNUSATDXOPZUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2S/c1-3-20-12-6-7-13-14(9-12)21-15(17-13)16(19)18-8-4-5-11(2)10-18/h6-7,9,11H,3-5,8,10H2,1-2H3.
What are the key properties of (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone?
(6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone has a molecular weight of 304.42 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethoxy-1,3-benzothiazol-2-yl)-(3-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 4558532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).