About 1-(4-methyl-1,3-thiazol-2-yl)ethanamine
1-(4-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 4558721) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)ethanamine |
| PubChem CID | 4558721 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | Cc1csc(C(C)N)n1 |
| InChI | InChI=1S/C6H10N2S/c1-4-3-9-6(8-4)5(2)7/h3,5H,7H2,1-2H3 |
| InChIKey | NSXQYSQZXMGRPJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methyl-1,3-thiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine?
The IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine (CID 4558721) is 1-(4-methyl-1,3-thiazol-2-yl)ethanamine.
What is the SMILES notation for 1-(4-methyl-1,3-thiazol-2-yl)ethanamine?
The canonical SMILES for 1-(4-methyl-1,3-thiazol-2-yl)ethanamine is Cc1csc(C(C)N)n1.
What is the InChIKey of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine?
The InChIKey is NSXQYSQZXMGRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-4-3-9-6(8-4)5(2)7/h3,5H,7H2,1-2H3.
What are the key properties of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine?
1-(4-methyl-1,3-thiazol-2-yl)ethanamine has a molecular weight of 142.23 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,3-thiazol-2-yl)ethanamine is sourced from PubChem (CID 4558721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).