About 2,4-dichloro-6-iodophenol
2,4-dichloro-6-iodophenol (PubChem CID 4559010) has the molecular formula C6H3Cl2IO
and a molecular weight of 288.90 g/mol. Its IUPAC name is 2,4-dichloro-6-iodophenol.
Molecular Properties
| Compound Name | 2,4-dichloro-6-iodophenol |
| PubChem CID | 4559010 |
| Molecular Formula | C6H3Cl2IO |
| Molecular Weight | 288.90 g/mol |
| Exact Mass | 287.86 |
| IUPAC Name | 2,4-dichloro-6-iodophenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1I |
| InChI | InChI=1S/C6H3Cl2IO/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| InChIKey | UMDKVOOEGYNMEB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-6-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-iodophenol?
The IUPAC name of 2,4-dichloro-6-iodophenol (CID 4559010) is 2,4-dichloro-6-iodophenol.
What is the SMILES notation for 2,4-dichloro-6-iodophenol?
The canonical SMILES for 2,4-dichloro-6-iodophenol is Oc1c(Cl)cc(Cl)cc1I.
What is the InChIKey of 2,4-dichloro-6-iodophenol?
The InChIKey is UMDKVOOEGYNMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2IO/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H.
What are the key properties of 2,4-dichloro-6-iodophenol?
2,4-dichloro-6-iodophenol has a molecular weight of 288.90 g/mol, XLogP of 3.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-iodophenol is sourced from PubChem (CID 4559010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).