C23H31N3S — CID 4559464
1-[[1-(1-phenylethyl)pyrrolidin-3-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea (PubChem CID 4559464) has the molecular formula C23H31N3S and a molecular weight of 381.59 g/mol. Its IUPAC name is 1-[[1-(1-phenylethyl)pyrrolidin-3-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-[[1-(1-phenylethyl)pyrrolidin-3-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 4559464 |
| Molecular Formula | C23H31N3S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-[[1-(1-phenylethyl)pyrrolidin-3-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea |
| SMILES | Cc1cc(C)c(NC(=S)NCC2CCN(C(C)c3ccccc3)C2)c(C)c1 |
| InChI | InChI=1S/C23H31N3S/c1-16-12-17(2)22(18(3)13-16)25-23(27)24-14-20-10-11-26(15-20)19(4)21-8-6-5-7-9-21/h5-9,12-13,19-20H,10-11,14-15H2,1-4H3,(H2,24,25,27) |
| InChIKey | AQNQKVLAOFOLOO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|