About 1,4-dibutoxynaphthalene-2,3-dicarbonitrile
1,4-dibutoxynaphthalene-2,3-dicarbonitrile (PubChem CID 4560580) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is 1,4-dibutoxynaphthalene-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 1,4-dibutoxynaphthalene-2,3-dicarbonitrile |
| PubChem CID | 4560580 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1,4-dibutoxynaphthalene-2,3-dicarbonitrile |
| SMILES | CCCCOc1c(C#N)c(C#N)c(OCCCC)c2ccccc12 |
| InChI | InChI=1S/C20H22N2O2/c1-3-5-11-23-19-15-9-7-8-10-16(15)20(24-12-6-4-2)18(14-22)17(19)13-21/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | YXJSABMTZAXNKC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibutoxynaphthalene-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibutoxynaphthalene-2,3-dicarbonitrile?
The IUPAC name of 1,4-dibutoxynaphthalene-2,3-dicarbonitrile (CID 4560580) is 1,4-dibutoxynaphthalene-2,3-dicarbonitrile.
What is the SMILES notation for 1,4-dibutoxynaphthalene-2,3-dicarbonitrile?
The canonical SMILES for 1,4-dibutoxynaphthalene-2,3-dicarbonitrile is CCCCOc1c(C#N)c(C#N)c(OCCCC)c2ccccc12.
What is the InChIKey of 1,4-dibutoxynaphthalene-2,3-dicarbonitrile?
The InChIKey is YXJSABMTZAXNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2/c1-3-5-11-23-19-15-9-7-8-10-16(15)20(24-12-6-4-2)18(14-22)17(19)13-21/h7-10H,3-6,11-12H2,1-2H3.
What are the key properties of 1,4-dibutoxynaphthalene-2,3-dicarbonitrile?
1,4-dibutoxynaphthalene-2,3-dicarbonitrile has a molecular weight of 322.41 g/mol, XLogP of 4.94, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibutoxynaphthalene-2,3-dicarbonitrile is sourced from PubChem (CID 4560580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).