C40H26N2O4 — CID 4561521
6,13-dibenzhydryl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 4561521) has the molecular formula C40H26N2O4 and a molecular weight of 598.66 g/mol. Its IUPAC name is 6,13-dibenzhydryl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-dibenzhydryl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 4561521 |
| Molecular Formula | C40H26N2O4 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | 6,13-dibenzhydryl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1C(c1ccccc1)c1ccccc1)C(=O)N(C(c1ccccc1)c1ccccc1)C3=O |
| InChI | InChI=1S/C40H26N2O4/c43-37-29-21-23-31-34-32(40(46)42(39(31)45)36(27-17-9-3-10-18-27)28-19-11-4-12-20-28)24-22-30(33(29)34)38(44)41(37)35(25-13-5-1-6-14-25)26-15-7-2-8-16-26/h1-24,35-36H |
| InChIKey | GTKAMUHWWUFCJH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|