C27H23N3O4S — CID 4561595
2-[2-methoxy-4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 4561595) has the molecular formula C27H23N3O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-methoxy-4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 4561595 |
| Molecular Formula | C27H23N3O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-[2-methoxy-4-[[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | COc1ccc(CN2C(=O)C(=Cc3ccc(OCC#N)c(OC)c3)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23N3O4S/c1-32-22-11-8-19(9-12-22)18-30-26(31)25(35-27(30)29-21-6-4-3-5-7-21)17-20-10-13-23(34-15-14-28)24(16-20)33-2/h3-13,16-17H,15,18H2,1-2H3/b25-17?,29-27- |
| InChIKey | VIIYSJXTTXYLTA-UMCQNWBNSA-N |
| XLogP | 5.41 |
| TPSA | 84.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|