C8H9F4N3 — CID 4561709
N'-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine (PubChem CID 4561709) has the molecular formula C8H9F4N3 and a molecular weight of 223.17 g/mol. Its IUPAC name is N'-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine.
| Compound Name | N'-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 4561709 |
| Molecular Formula | C8H9F4N3 |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | N'-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine |
| SMILES | NCCCNc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C8H9F4N3/c9-4-6(14-3-1-2-13)5(10)8(12)15-7(4)11/h1-3,13H2,(H,14,15) |
| InChIKey | OUMNTBZHXXAOSP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|