About 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole
1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 4561760) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
Molecular Properties
| Compound Name | 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| PubChem CID | 4561760 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | Cn1nc(-c2ccncc2)c2c1NCC2 |
| InChI | InChI=1S/C11H12N4/c1-15-11-9(4-7-13-11)10(14-15)8-2-5-12-6-3-8/h2-3,5-6,13H,4,7H2,1H3 |
| InChIKey | COTDTRMWIVAKEO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
The IUPAC name of 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (CID 4561760) is 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
What is the SMILES notation for 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
The canonical SMILES for 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole is Cn1nc(-c2ccncc2)c2c1NCC2.
What is the InChIKey of 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
The InChIKey is COTDTRMWIVAKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c1-15-11-9(4-7-13-11)10(14-15)8-2-5-12-6-3-8/h2-3,5-6,13H,4,7H2,1H3.
What are the key properties of 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole?
1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole has a molecular weight of 200.25 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-pyridin-4-yl-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole is sourced from PubChem (CID 4561760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).