About 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine
2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine (PubChem CID 4562063) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine.
Molecular Properties
| Compound Name | 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine |
| PubChem CID | 4562063 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine |
| SMILES | COc1ccc2c(c1)C(=NN=C(N)N)c1cc(OC)ccc1-2 |
| InChI | InChI=1S/C16H16N4O2/c1-21-9-3-5-11-12-6-4-10(22-2)8-14(12)15(13(11)7-9)19-20-16(17)18/h3-8H,1-2H3,(H4,17,18,20) |
| InChIKey | SLVZZBNAYXVHEJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine?
The IUPAC name of 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine (CID 4562063) is 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine.
What is the SMILES notation for 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine?
The canonical SMILES for 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine is COc1ccc2c(c1)C(=NN=C(N)N)c1cc(OC)ccc1-2.
What is the InChIKey of 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine?
The InChIKey is SLVZZBNAYXVHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-21-9-3-5-11-12-6-4-10(22-2)8-14(12)15(13(11)7-9)19-20-16(17)18/h3-8H,1-2H3,(H4,17,18,20).
What are the key properties of 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine?
2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine has a molecular weight of 296.33 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,7-dimethoxyfluoren-9-ylidene)amino]guanidine is sourced from PubChem (CID 4562063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).