C21H25N3OS — CID 4562392
4-methyl-N-(3-oxo-1,3-diphenylpropyl)piperazine-1-carbothioamide (PubChem CID 4562392) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 4-methyl-N-(3-oxo-1,3-diphenylpropyl)piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-(3-oxo-1,3-diphenylpropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4562392 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-methyl-N-(3-oxo-1,3-diphenylpropyl)piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)NC(CC(=O)c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N3OS/c1-23-12-14-24(15-13-23)21(26)22-19(17-8-4-2-5-9-17)16-20(25)18-10-6-3-7-11-18/h2-11,19H,12-16H2,1H3,(H,22,26) |
| InChIKey | XYZHKEXSSYJORP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|