C23H20BrN2OPS — CID 4563171
3-(4-bromophenyl)-4-ethylsulfanyl-1,5-diphenyl-1,2,4lambda5-diazaphosphinine 4-oxide (PubChem CID 4563171) has the molecular formula C23H20BrN2OPS and a molecular weight of 483.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-4-ethylsulfanyl-1,5-diphenyl-1,2,4lambda5-diazaphosphinine 4-oxide.
| Compound Name | 3-(4-bromophenyl)-4-ethylsulfanyl-1,5-diphenyl-1,2,4lambda5-diazaphosphinine 4-oxide |
|---|---|
| PubChem CID | 4563171 |
| Molecular Formula | C23H20BrN2OPS |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 3-(4-bromophenyl)-4-ethylsulfanyl-1,5-diphenyl-1,2,4lambda5-diazaphosphinine 4-oxide |
| SMILES | CCSP1(=O)C(c2ccccc2)=CN(c2ccccc2)N=C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H20BrN2OPS/c1-2-29-28(27)22(18-9-5-3-6-10-18)17-26(21-11-7-4-8-12-21)25-23(28)19-13-15-20(24)16-14-19/h3-17H,2H2,1H3 |
| InChIKey | UBZIRBDEKYNARV-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|