About (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate
(3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate (PubChem CID 4563615) has the molecular formula C15H11F2N3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate.
Molecular Properties
| Compound Name | (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate |
| PubChem CID | 4563615 |
| Molecular Formula | C15H11F2N3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate |
| SMILES | N#CN/C(=N/c1cccc(F)c1)SCc1cccc(F)c1 |
| InChI | InChI=1S/C15H11F2N3S/c16-12-4-1-3-11(7-12)9-21-15(19-10-18)20-14-6-2-5-13(17)8-14/h1-8H,9H2,(H,19,20) |
| InChIKey | UMJADEHZELTLFJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate?
The IUPAC name of (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate (CID 4563615) is (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate.
What is the SMILES notation for (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate?
The canonical SMILES for (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate is N#CN/C(=N/c1cccc(F)c1)SCc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate?
The InChIKey is UMJADEHZELTLFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2N3S/c16-12-4-1-3-11(7-12)9-21-15(19-10-18)20-14-6-2-5-13(17)8-14/h1-8H,9H2,(H,19,20).
What are the key properties of (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate?
(3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate has a molecular weight of 303.34 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl)methyl N-cyano-N'-(3-fluorophenyl)carbamimidothioate is sourced from PubChem (CID 4563615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).