About ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate
ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate (PubChem CID 4563985) has the molecular formula C7H10F3N3O2S
and a molecular weight of 257.24 g/mol. Its IUPAC name is ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate |
| PubChem CID | 4563985 |
| Molecular Formula | C7H10F3N3O2S |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)CC(=NNC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N3O2S/c1-2-15-5(14)3-4(7(8,9)10)12-13-6(11)16/h2-3H2,1H3,(H3,11,13,16) |
| InChIKey | FAAOCAOFGTVZOF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
The IUPAC name of ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate (CID 4563985) is ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate.
What is the SMILES notation for ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
The canonical SMILES for ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate is CCOC(=O)CC(=NNC(N)=S)C(F)(F)F.
What is the InChIKey of ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
The InChIKey is FAAOCAOFGTVZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3N3O2S/c1-2-15-5(14)3-4(7(8,9)10)12-13-6(11)16/h2-3H2,1H3,(H3,11,13,16).
What are the key properties of ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate has a molecular weight of 257.24 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate is sourced from PubChem (CID 4563985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).