C13H6BrF5N2O — CID 4564059
2-bromo-6-[[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 4564059) has the molecular formula C13H6BrF5N2O and a molecular weight of 381.10 g/mol. Its IUPAC name is 2-bromo-6-[[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-6-[[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 4564059 |
| Molecular Formula | C13H6BrF5N2O |
| Molecular Weight | 381.10 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 2-bromo-6-[[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Br)cccc1C=NNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H6BrF5N2O/c14-6-3-1-2-5(13(6)22)4-20-21-12-10(18)8(16)7(15)9(17)11(12)19/h1-4,21-22H |
| InChIKey | ATALUDPSYPCALV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.10 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|