About [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate
[1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 4564616) has the molecular formula C22H27NO6
and a molecular weight of 401.46 g/mol. Its IUPAC name is [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate.
Molecular Properties
| Compound Name | [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate |
| PubChem CID | 4564616 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | CCc1ccc(NC(=O)C(C)OC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H27NO6/c1-6-15-7-9-17(10-8-15)23-22(25)14(2)29-20(24)13-16-11-18(26-3)21(28-5)19(12-16)27-4/h7-12,14H,6,13H2,1-5H3,(H,23,25) |
| InChIKey | YYHNQDTYLGFHFW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate?
The IUPAC name of [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate (CID 4564616) is [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate.
What is the SMILES notation for [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate?
The canonical SMILES for [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate is CCc1ccc(NC(=O)C(C)OC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate?
The InChIKey is YYHNQDTYLGFHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO6/c1-6-15-7-9-17(10-8-15)23-22(25)14(2)29-20(24)13-16-11-18(26-3)21(28-5)19(12-16)27-4/h7-12,14H,6,13H2,1-5H3,(H,23,25).
What are the key properties of [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate?
[1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate has a molecular weight of 401.46 g/mol, XLogP of 3.39, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate is sourced from PubChem (CID 4564616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).