C15H11N3O — CID 4564672
4-(3-phenyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)benzonitrile (PubChem CID 4564672) has the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-(3-phenyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)benzonitrile.
| Compound Name | 4-(3-phenyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 4564672 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-(3-phenyl-2,5-dihydro-1,2,4-oxadiazol-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2N=C(c3ccccc3)NO2)cc1 |
| InChI | InChI=1S/C15H11N3O/c16-10-11-6-8-13(9-7-11)15-17-14(18-19-15)12-4-2-1-3-5-12/h1-9,15H,(H,17,18) |
| InChIKey | BJFXICTTWGARCG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |