C21H33N3S — CID 4564981
4-[methyl-(2-methylcyclohexyl)amino]-N-(2-methylphenyl)piperidine-1-carbothioamide (PubChem CID 4564981) has the molecular formula C21H33N3S and a molecular weight of 359.58 g/mol. Its IUPAC name is 4-[methyl-(2-methylcyclohexyl)amino]-N-(2-methylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[methyl-(2-methylcyclohexyl)amino]-N-(2-methylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 4564981 |
| Molecular Formula | C21H33N3S |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 4-[methyl-(2-methylcyclohexyl)amino]-N-(2-methylphenyl)piperidine-1-carbothioamide |
| SMILES | Cc1ccccc1NC(=S)N1CCC(N(C)C2CCCCC2C)CC1 |
| InChI | InChI=1S/C21H33N3S/c1-16-8-4-6-10-19(16)22-21(25)24-14-12-18(13-15-24)23(3)20-11-7-5-9-17(20)2/h4,6,8,10,17-18,20H,5,7,9,11-15H2,1-3H3,(H,22,25) |
| InChIKey | TWLQFTCLKAJKAP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|