C20H15BrN2O3S — CID 4564987
[4-[(5-bromo-6,7-dimethyl-1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] acetate (PubChem CID 4564987) has the molecular formula C20H15BrN2O3S and a molecular weight of 443.32 g/mol. Its IUPAC name is [4-[(5-bromo-6,7-dimethyl-1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] acetate.
| Compound Name | [4-[(5-bromo-6,7-dimethyl-1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 4564987 |
| Molecular Formula | C20H15BrN2O3S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | [4-[(5-bromo-6,7-dimethyl-1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=c2sc3nc4c(Br)c(C)c(C)cc4n3c2=O)cc1 |
| InChI | InChI=1S/C20H15BrN2O3S/c1-10-8-15-18(17(21)11(10)2)22-20-23(15)19(25)16(27-20)9-13-4-6-14(7-5-13)26-12(3)24/h4-9H,1-3H3 |
| InChIKey | WKLMZBJGYFFAAV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|