C18H14N4O4 — CID 4566805
3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 4566805) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4566805 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc3ccc(C)cc3[nH]2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H14N4O4/c1-10-3-4-13-14(5-10)21-18(20-13)12(9-19)6-11-7-15(22(24)25)17(23)16(8-11)26-2/h3-8,23H,1-2H3,(H,20,21) |
| InChIKey | MEMKDJAGJLJEOO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|