About [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 4567408) has the molecular formula C15H20F3NO4
and a molecular weight of 335.32 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate |
| PubChem CID | 4567408 |
| Molecular Formula | C15H20F3NO4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(O)(C3)C1)C2)NCC(F)(F)F |
| InChI | InChI=1S/C15H20F3NO4/c16-15(17,18)8-19-11(20)6-23-12(21)13-2-9-1-10(3-13)5-14(22,4-9)7-13/h9-10,22H,1-8H2,(H,19,20) |
| InChIKey | VVDLMNKSXYPOLH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate?
The IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate (CID 4567408) is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate.
What is the SMILES notation for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate?
The canonical SMILES for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate is O=C(COC(=O)C12CC3CC(CC(O)(C3)C1)C2)NCC(F)(F)F.
What is the InChIKey of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate?
The InChIKey is VVDLMNKSXYPOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3NO4/c16-15(17,18)8-19-11(20)6-23-12(21)13-2-9-1-10(3-13)5-14(22,4-9)7-13/h9-10,22H,1-8H2,(H,19,20).
What are the key properties of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate?
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate has a molecular weight of 335.32 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-hydroxyadamantane-1-carboxylate is sourced from PubChem (CID 4567408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).