About 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide
4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide (PubChem CID 4567717) has the molecular formula C17H25N3O2
and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide.
Molecular Properties
| Compound Name | 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide |
| PubChem CID | 4567717 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide |
| SMILES | CC1CCCC(NCC(=O)Nc2ccc(C(N)=O)cc2)C1C |
| InChI | InChI=1S/C17H25N3O2/c1-11-4-3-5-15(12(11)2)19-10-16(21)20-14-8-6-13(7-9-14)17(18)22/h6-9,11-12,15,19H,3-5,10H2,1-2H3,(H2,18,22)(H,20,21) |
| InChIKey | QGYCWXHMMROHGB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide?
The IUPAC name of 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide (CID 4567717) is 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide.
What is the SMILES notation for 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide?
The canonical SMILES for 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide is CC1CCCC(NCC(=O)Nc2ccc(C(N)=O)cc2)C1C.
What is the InChIKey of 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide?
The InChIKey is QGYCWXHMMROHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O2/c1-11-4-3-5-15(12(11)2)19-10-16(21)20-14-8-6-13(7-9-14)17(18)22/h6-9,11-12,15,19H,3-5,10H2,1-2H3,(H2,18,22)(H,20,21).
What are the key properties of 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide?
4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide has a molecular weight of 303.41 g/mol, XLogP of 2.14, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]benzamide is sourced from PubChem (CID 4567717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).