About 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole
2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole (PubChem CID 4568582) has the molecular formula C21H13N3O2
and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole |
| PubChem CID | 4568582 |
| Molecular Formula | C21H13N3O2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc2c3ccccc3c3ccccc3c2[nH]1 |
| InChI | InChI=1S/C21H13N3O2/c25-24(26)18-12-6-5-11-17(18)21-22-19-15-9-3-1-7-13(15)14-8-2-4-10-16(14)20(19)23-21/h1-12H,(H,22,23) |
| InChIKey | DLAAKPOAAYYMIX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
The IUPAC name of 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole (CID 4568582) is 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole.
What is the SMILES notation for 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
The canonical SMILES for 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole is O=[N+]([O-])c1ccccc1-c1nc2c3ccccc3c3ccccc3c2[nH]1.
What is the InChIKey of 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
The InChIKey is DLAAKPOAAYYMIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13N3O2/c25-24(26)18-12-6-5-11-17(18)21-22-19-15-9-3-1-7-13(15)14-8-2-4-10-16(14)20(19)23-21/h1-12H,(H,22,23).
What are the key properties of 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole has a molecular weight of 339.35 g/mol, XLogP of 5.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)-1H-phenanthro[9,10-d]imidazole is sourced from PubChem (CID 4568582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).