C19H21N7 — CID 4568643
1-(2,4-dimethylphenyl)-N-(3-imidazol-1-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 4568643) has the molecular formula C19H21N7 and a molecular weight of 347.43 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-N-(3-imidazol-1-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(2,4-dimethylphenyl)-N-(3-imidazol-1-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4568643 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-N-(3-imidazol-1-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-n2ncc3c(NCCCn4ccnc4)ncnc32)c(C)c1 |
| InChI | InChI=1S/C19H21N7/c1-14-4-5-17(15(2)10-14)26-19-16(11-24-26)18(22-12-23-19)21-6-3-8-25-9-7-20-13-25/h4-5,7,9-13H,3,6,8H2,1-2H3,(H,21,22,23) |
| InChIKey | PWGWVVNEIJVBET-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|