About 1H-benzimidazol-1-ium
1H-benzimidazol-1-ium (PubChem CID 4569300) has the molecular formula C7H7N2+
and a molecular weight of 119.15 g/mol. Its IUPAC name is 1H-benzimidazol-1-ium.
Molecular Properties
| Compound Name | 1H-benzimidazol-1-ium |
| PubChem CID | 4569300 |
| Molecular Formula | C7H7N2+ |
| Molecular Weight | 119.15 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 1H-benzimidazol-1-ium |
| SMILES | C1=Nc2ccccc2[NH2+]1 |
| InChI | InChI=1S/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9)/p+1 |
| InChIKey | HYZJCKYKOHLVJF-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 28.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-1-ium?
The IUPAC name of 1H-benzimidazol-1-ium (CID 4569300) is 1H-benzimidazol-1-ium.
What is the SMILES notation for 1H-benzimidazol-1-ium?
The canonical SMILES for 1H-benzimidazol-1-ium is C1=Nc2ccccc2[NH2+]1.
What is the InChIKey of 1H-benzimidazol-1-ium?
The InChIKey is HYZJCKYKOHLVJF-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9)/p+1.
What are the key properties of 1H-benzimidazol-1-ium?
1H-benzimidazol-1-ium has a molecular weight of 119.15 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-1-ium is sourced from PubChem (CID 4569300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).