C20H21NO5S — CID 4569952
4-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoic acid (PubChem CID 4569952) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4569952 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-[(3-methoxycarbonyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoic acid |
| SMILES | COC(=O)c1c(NC(=O)CCC(=O)O)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C20H21NO5S/c1-26-20(25)18-14-8-7-13(12-5-3-2-4-6-12)11-15(14)27-19(18)21-16(22)9-10-17(23)24/h2-6,13H,7-11H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | JWQDYWSEMAUTKI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|