C11H8BrNO3 — CID 4569957
methyl 5-(4-bromophenyl)-1,2-oxazole-3-carboxylate (PubChem CID 4569957) has the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. Its IUPAC name is methyl 5-(4-bromophenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-(4-bromophenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 4569957 |
| Molecular Formula | C11H8BrNO3 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | methyl 5-(4-bromophenyl)-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(Br)cc2)on1 |
| InChI | InChI=1S/C11H8BrNO3/c1-15-11(14)9-6-10(16-13-9)7-2-4-8(12)5-3-7/h2-6H,1H3 |
| InChIKey | QDMKBPFKVHCOEZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |