C27H27N3O2S2 — CID 4570976
2-[(4-oxo-3-prop-2-enyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-(4-phenylphenyl)acetamide (PubChem CID 4570976) has the molecular formula C27H27N3O2S2 and a molecular weight of 489.67 g/mol. Its IUPAC name is 2-[(4-oxo-3-prop-2-enyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-(4-phenylphenyl)acetamide.
| Compound Name | 2-[(4-oxo-3-prop-2-enyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 4570976 |
| Molecular Formula | C27H27N3O2S2 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[(4-oxo-3-prop-2-enyl-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-(4-phenylphenyl)acetamide |
| SMILES | C=CCN1C(=O)c2c(sc3c2CCCC3)NC1SCC(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3O2S2/c1-2-16-30-26(32)24-21-10-6-7-11-22(21)34-25(24)29-27(30)33-17-23(31)28-20-14-12-19(13-15-20)18-8-4-3-5-9-18/h2-5,8-9,12-15,27,29H,1,6-7,10-11,16-17H2,(H,28,31) |
| InChIKey | SJHKGDMTYSGIPL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|