About 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate
1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (PubChem CID 4571181) has the molecular formula C22H15NO3S
and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
Molecular Properties
| Compound Name | 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| PubChem CID | 4571181 |
| Molecular Formula | C22H15NO3S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| SMILES | CC(C#N)OC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H15NO3S/c1-13(11-23)26-20(24)12-27-19-10-9-15-14-5-2-3-6-16(14)22(25)18-8-4-7-17(19)21(15)18/h2-10,13H,12H2,1H3 |
| InChIKey | JWVMSOLHWUJOON-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate?
The IUPAC name of 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (CID 4571181) is 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
What is the SMILES notation for 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate?
The canonical SMILES for 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate is CC(C#N)OC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2.
What is the InChIKey of 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate?
The InChIKey is JWVMSOLHWUJOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO3S/c1-13(11-23)26-20(24)12-27-19-10-9-15-14-5-2-3-6-16(14)22(25)18-8-4-7-17(19)21(15)18/h2-10,13H,12H2,1H3.
What are the key properties of 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate?
1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate has a molecular weight of 373.43 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethyl 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate is sourced from PubChem (CID 4571181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).