About ethyl 2-isocyanopropanoate
ethyl 2-isocyanopropanoate (PubChem CID 4571250) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is ethyl 2-isocyanopropanoate.
Molecular Properties
| Compound Name | ethyl 2-isocyanopropanoate |
| PubChem CID | 4571250 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | ethyl 2-isocyanopropanoate |
| SMILES | [C-]#[N+]C(C)C(=O)OCC |
| InChI | InChI=1S/C6H9NO2/c1-4-9-6(8)5(2)7-3/h5H,4H2,1-2H3 |
| InChIKey | AQUISJFHBNLTCK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-isocyanopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-isocyanopropanoate?
The IUPAC name of ethyl 2-isocyanopropanoate (CID 4571250) is ethyl 2-isocyanopropanoate.
What is the SMILES notation for ethyl 2-isocyanopropanoate?
The canonical SMILES for ethyl 2-isocyanopropanoate is [C-]#[N+]C(C)C(=O)OCC.
What is the InChIKey of ethyl 2-isocyanopropanoate?
The InChIKey is AQUISJFHBNLTCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-9-6(8)5(2)7-3/h5H,4H2,1-2H3.
What are the key properties of ethyl 2-isocyanopropanoate?
ethyl 2-isocyanopropanoate has a molecular weight of 127.14 g/mol, XLogP of 0.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-isocyanopropanoate is sourced from PubChem (CID 4571250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).