About 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one
3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one (PubChem CID 4571723) has the molecular formula C17H20N4O4
and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one |
| PubChem CID | 4571723 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one |
| SMILES | CC1CCCC(C)N1C(=O)Cn1cnc2cc([N+](=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C17H20N4O4/c1-11-4-3-5-12(2)20(11)16(22)9-19-10-18-15-8-13(21(24)25)6-7-14(15)17(19)23/h6-8,10-12H,3-5,9H2,1-2H3 |
| InChIKey | QLKONCNMXNWNKG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one?
The IUPAC name of 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one (CID 4571723) is 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one.
What is the SMILES notation for 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one?
The canonical SMILES for 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one is CC1CCCC(C)N1C(=O)Cn1cnc2cc([N+](=O)[O-])ccc2c1=O.
What is the InChIKey of 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one?
The InChIKey is QLKONCNMXNWNKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O4/c1-11-4-3-5-12(2)20(11)16(22)9-19-10-18-15-8-13(21(24)25)6-7-14(15)17(19)23/h6-8,10-12H,3-5,9H2,1-2H3.
What are the key properties of 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one?
3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one has a molecular weight of 344.37 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-7-nitroquinazolin-4-one is sourced from PubChem (CID 4571723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).