C21H22IN5O2S — CID 4572601
N-[1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 4572601) has the molecular formula C21H22IN5O2S and a molecular weight of 535.41 g/mol. Its IUPAC name is N-[1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | N-[1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 4572601 |
| Molecular Formula | C21H22IN5O2S |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | N-[1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSc1nnc(C(C)NC(=O)c2ccccc2)n1C |
| InChI | InChI=1S/C21H22IN5O2S/c1-13-11-16(22)9-10-17(13)24-18(28)12-30-21-26-25-19(27(21)3)14(2)23-20(29)15-7-5-4-6-8-15/h4-11,14H,12H2,1-3H3,(H,23,29)(H,24,28) |
| InChIKey | SMWJNHRLPVVRMJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|