C15H19N3O3 — CID 4573266
4-(2,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (PubChem CID 4573266) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-(2,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine.
| Compound Name | 4-(2,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 4573266 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-(2,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
| SMILES | COc1cc(OC)c(C2NCCc3[nH]cnc32)cc1OC |
| InChI | InChI=1S/C15H19N3O3/c1-19-11-7-13(21-3)12(20-2)6-9(11)14-15-10(4-5-16-14)17-8-18-15/h6-8,14,16H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | PLGUDKSDYSTKKL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |