C14H18N3OS+ — CID 4573900
3,3-dimethyl-1-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]butan-2-one (PubChem CID 4573900) has the molecular formula C14H18N3OS+ and a molecular weight of 276.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]butan-2-one |
|---|---|
| PubChem CID | 4573900 |
| Molecular Formula | C14H18N3OS+ |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3,3-dimethyl-1-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]butan-2-one |
| SMILES | CC(C)(C)C(=O)CSc1nc[nH][n+]1-c1ccccc1 |
| InChI | InChI=1S/C14H17N3OS/c1-14(2,3)12(18)9-19-13-15-10-16-17(13)11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3/p+1 |
| InChIKey | BQDWICWJYYXCDJ-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|