C28H26Cl2N2Sn — CID 4574299
dichloro(diethyl)stannane;4,7-diphenyl-1,10-phenanthroline (PubChem CID 4574299) has the molecular formula C28H26Cl2N2Sn and a molecular weight of 580.15 g/mol. Its IUPAC name is dichloro(diethyl)stannane;4,7-diphenyl-1,10-phenanthroline.
| Compound Name | dichloro(diethyl)stannane;4,7-diphenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 4574299 |
| Molecular Formula | C28H26Cl2N2Sn |
| Molecular Weight | 580.15 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | dichloro(diethyl)stannane;4,7-diphenyl-1,10-phenanthroline |
| SMILES | CC[Sn](Cl)(Cl)CC.c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.2C2H5.2ClH.Sn/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;2*1-2;;;/h1-16H;2*1H2,2H3;2*1H;/q;;;;;+2/p-2 |
| InChIKey | HVNYPEBMVNAXJI-UHFFFAOYSA-L |
| XLogP | 9.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.15 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|