C21H26N2O4S — CID 4574357
N-cyclopentyl-2-[4-[(3,5-dimethylphenyl)sulfamoyl]phenoxy]acetamide (PubChem CID 4574357) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-[(3,5-dimethylphenyl)sulfamoyl]phenoxy]acetamide.
| Compound Name | N-cyclopentyl-2-[4-[(3,5-dimethylphenyl)sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4574357 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-cyclopentyl-2-[4-[(3,5-dimethylphenyl)sulfamoyl]phenoxy]acetamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(OCC(=O)NC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C21H26N2O4S/c1-15-11-16(2)13-18(12-15)23-28(25,26)20-9-7-19(8-10-20)27-14-21(24)22-17-5-3-4-6-17/h7-13,17,23H,3-6,14H2,1-2H3,(H,22,24) |
| InChIKey | NEONUXLPVUNXNV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |